C19H28Br2N4O — CID 118724729
14-Oxa-11,17-diaza-1,7-diazoniatricyclo[16.2.2.27,10]tetracosa-1(21),7,9,18(22),19,23-hexaene dibromide (PubChem CID 118724729) has the molecular formula C19H28Br2N4O and a molecular weight of 488.30 g/mol. Its IUPAC name is 14-oxa-11,17-diaza-1,7-diazoniatricyclo[16.2.2.27,10]tetracosa-1(21),7,9,18(22),19,23-hexaene dibromide.
| Compound Name | 14-Oxa-11,17-diaza-1,7-diazoniatricyclo[16.2.2.27,10]tetracosa-1(21),7,9,18(22),19,23-hexaene dibromide |
|---|---|
| PubChem CID | 118724729 |
| Molecular Formula | C19H28Br2N4O |
| Molecular Weight | 488.30 g/mol |
| Exact Mass | 488.06 |
| IUPAC Name | 14-oxa-11,17-diaza-1,7-diazoniatricyclo[16.2.2.27,10]tetracosa-1(21),7,9,18(22),19,23-hexaene dibromide |
| SMILES | C1CC[N+]2=CC=C(C=C2)NCCOCCNC3=CC=[N+](CC1)C=C3.[Br-].[Br-] |
| InChI | InChI=1S/C19H26N4O.2BrH/c1-2-10-22-12-4-18(5-13-22)20-8-16-24-17-9-21-19-6-14-23(11-3-1)15-7-19;;/h4-7,12-15H,1-3,8-11,16-17H2;2*1H |
| InChIKey | QIHJHPQZCGPOCC-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 41.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | 295 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|