C18H26Br2N4O2 — CID 118724731
4,14-dioxa-11,17-diaza-1,7-diazoniatricyclo[16.2.2.27,10]tetracosa-1(21),7,9,18(22),19,23-hexaene dibromide (PubChem CID 118724731) has the molecular formula C18H26Br2N4O2 and a molecular weight of 490.24 g/mol. Its IUPAC name is 4,14-dioxa-11,17-diaza-1,7-diazoniatricyclo[16.2.2.27,10]tetracosa-1(21),7,9,18(22),19,23-hexaene dibromide.
| Compound Name | 4,14-dioxa-11,17-diaza-1,7-diazoniatricyclo[16.2.2.27,10]tetracosa-1(21),7,9,18(22),19,23-hexaene dibromide |
|---|---|
| PubChem CID | 118724731 |
| Molecular Formula | C18H26Br2N4O2 |
| Molecular Weight | 490.24 g/mol |
| Exact Mass | 488.04 |
| IUPAC Name | 4,14-dioxa-11,17-diaza-1,7-diazoniatricyclo[16.2.2.27,10]tetracosa-1(21),7,9,18(22),19,23-hexaene dibromide |
| SMILES | [Br-].[Br-].c1c[n+]2ccc1NCCOCCNc1cc[n+](cc1)CCOCC2 |
| InChI | InChI=1S/C18H24N4O2.2BrH/c1-7-21-8-2-17(1)19-5-13-23-14-6-20-18-3-9-22(10-4-18)12-16-24-15-11-21;;/h1-4,7-10H,5-6,11-16H2;2*1H |
| InChIKey | GBJWRLKUEHEFGC-UHFFFAOYSA-N |
| XLogP | -5.16 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.24 |
| LogP ≤ 5 | -5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|