C19H28Br2N4O — CID 118724733
4-oxa-11,17-diaza-1,7-diazoniatricyclo[16.2.2.27,10]tetracosa-1(21),7,9,18(22),19,23-hexaene dibromide (PubChem CID 118724733) has the molecular formula C19H28Br2N4O and a molecular weight of 488.27 g/mol. Its IUPAC name is 4-oxa-11,17-diaza-1,7-diazoniatricyclo[16.2.2.27,10]tetracosa-1(21),7,9,18(22),19,23-hexaene dibromide.
| Compound Name | 4-oxa-11,17-diaza-1,7-diazoniatricyclo[16.2.2.27,10]tetracosa-1(21),7,9,18(22),19,23-hexaene dibromide |
|---|---|
| PubChem CID | 118724733 |
| Molecular Formula | C19H28Br2N4O |
| Molecular Weight | 488.27 g/mol |
| Exact Mass | 486.06 |
| IUPAC Name | 4-oxa-11,17-diaza-1,7-diazoniatricyclo[16.2.2.27,10]tetracosa-1(21),7,9,18(22),19,23-hexaene dibromide |
| SMILES | [Br-].[Br-].c1c[n+]2ccc1NCCCCCNc1cc[n+](cc1)CCOCC2 |
| InChI | InChI=1S/C19H26N4O.2BrH/c1-2-8-20-18-4-10-22(11-5-18)14-16-24-17-15-23-12-6-19(7-13-23)21-9-3-1;;/h4-7,10-13H,1-3,8-9,14-17H2;2*1H |
| InChIKey | XILBMWKHHFNPRH-UHFFFAOYSA-N |
| XLogP | -4.01 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.27 |
| LogP ≤ 5 | -4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|