C35H40ClN3O3 — CID 118724761
(1R,4aS,9Z,10aR)-N-[(2S)-1-(2-chloroanilino)-1-oxo-3-phenylpropan-2-yl]-9-hydroxyimino-1,4a-dimethyl-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxamide (PubChem CID 118724761) has the molecular formula C35H40ClN3O3 and a molecular weight of 586.18 g/mol. Its IUPAC name is (1R,4aS,9Z,10aR)-N-[(2S)-1-(2-chloroanilino)-1-oxo-3-phenylpropan-2-yl]-9-hydroxyimino-1,4a-dimethyl-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxamide.
| Compound Name | (1R,4aS,9Z,10aR)-N-[(2S)-1-(2-chloroanilino)-1-oxo-3-phenylpropan-2-yl]-9-hydroxyimino-1,4a-dimethyl-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxamide |
|---|---|
| PubChem CID | 118724761 |
| Molecular Formula | C35H40ClN3O3 |
| Molecular Weight | 586.18 g/mol |
| Exact Mass | 585.28 |
| IUPAC Name | (1R,4aS,9Z,10aR)-N-[(2S)-1-(2-chloroanilino)-1-oxo-3-phenylpropan-2-yl]-9-hydroxyimino-1,4a-dimethyl-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxamide |
| SMILES | CC(C)c1ccc2c(c1)/C(=N\O)C[C@H]1[C@](C)(C(=O)N[C@@H](Cc3ccccc3)C(=O)Nc3ccccc3Cl)CCC[C@]21C |
| InChI | InChI=1S/C35H40ClN3O3/c1-22(2)24-15-16-26-25(20-24)29(39-42)21-31-34(26,3)17-10-18-35(31,4)33(41)38-30(19-23-11-6-5-7-12-23)32(40)37-28-14-9-8-13-27(28)36/h5-9,11-16,20,22,30-31,42H,10,17-19,21H2,1-4H3,(H,37,40)(H,38,41)/b39-29-/t30-,31+,34+,35+/m0/s1 |
| InChIKey | JXWOVYIMTNZQHR-OZVICKBXSA-N |
| XLogP | 7.48 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.18 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|