C27H32N4O2S — CID 118724860
N-[2-(naphthalen-1-ylamino)ethyl]-3-[2-(naphthalen-1-ylamino)ethylamino]propane-1-sulfonamide (PubChem CID 118724860) has the molecular formula C27H32N4O2S and a molecular weight of 476.65 g/mol. Its IUPAC name is N-[2-(naphthalen-1-ylamino)ethyl]-3-[2-(naphthalen-1-ylamino)ethylamino]propane-1-sulfonamide.
| Compound Name | N-[2-(naphthalen-1-ylamino)ethyl]-3-[2-(naphthalen-1-ylamino)ethylamino]propane-1-sulfonamide |
|---|---|
| PubChem CID | 118724860 |
| Molecular Formula | C27H32N4O2S |
| Molecular Weight | 476.65 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | N-[2-(naphthalen-1-ylamino)ethyl]-3-[2-(naphthalen-1-ylamino)ethylamino]propane-1-sulfonamide |
| SMILES | O=S(=O)(CCCNCCNc1cccc2ccccc12)NCCNc1cccc2ccccc12 |
| InChI | InChI=1S/C27H32N4O2S/c32-34(33,31-20-19-30-27-15-6-11-23-9-2-4-13-25(23)27)21-7-16-28-17-18-29-26-14-5-10-22-8-1-3-12-24(22)26/h1-6,8-15,28-31H,7,16-21H2 |
| InChIKey | PCOTXNMSKROTSK-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.65 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|