About acetic acid;6-[[(4-chloronaphthalen-1-yl)amino]methyl]quinazoline-2,4-diamine;hydrate
acetic acid;6-[[(4-chloronaphthalen-1-yl)amino]methyl]quinazoline-2,4-diamine;hydrate (PubChem CID 118725297) has the molecular formula C21H22ClN5O3
and a molecular weight of 427.89 g/mol. Its IUPAC name is acetic acid;6-[[(4-chloronaphthalen-1-yl)amino]methyl]quinazoline-2,4-diamine;hydrate.
Molecular Properties
| Compound Name | acetic acid;6-[[(4-chloronaphthalen-1-yl)amino]methyl]quinazoline-2,4-diamine;hydrate |
| PubChem CID | 118725297 |
| Molecular Formula | C21H22ClN5O3 |
| Molecular Weight | 427.89 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | acetic acid;6-[[(4-chloronaphthalen-1-yl)amino]methyl]quinazoline-2,4-diamine;hydrate |
| SMILES | CC(=O)O.Nc1nc(N)c2cc(CNc3ccc(Cl)c4ccccc34)ccc2n1.O |
| InChI | InChI=1S/C19H16ClN5.C2H4O2.H2O/c20-15-6-8-16(13-4-2-1-3-12(13)15)23-10-11-5-7-17-14(9-11)18(21)25-19(22)24-17;1-2(3)4;/h1-9,23H,10H2,(H4,21,22,24,25);1H3,(H,3,4);1H2 |
| InChIKey | UTUCDISLEQRRET-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 158.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.89 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze acetic acid;6-[[(4-chloronaphthalen-1-yl)amino]methyl]quinazoline-2,4-diamine;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;6-[[(4-chloronaphthalen-1-yl)amino]methyl]quinazoline-2,4-diamine;hydrate?
The IUPAC name of acetic acid;6-[[(4-chloronaphthalen-1-yl)amino]methyl]quinazoline-2,4-diamine;hydrate (CID 118725297) is acetic acid;6-[[(4-chloronaphthalen-1-yl)amino]methyl]quinazoline-2,4-diamine;hydrate.
What is the SMILES notation for acetic acid;6-[[(4-chloronaphthalen-1-yl)amino]methyl]quinazoline-2,4-diamine;hydrate?
The canonical SMILES for acetic acid;6-[[(4-chloronaphthalen-1-yl)amino]methyl]quinazoline-2,4-diamine;hydrate is CC(=O)O.Nc1nc(N)c2cc(CNc3ccc(Cl)c4ccccc34)ccc2n1.O.
What is the InChIKey of acetic acid;6-[[(4-chloronaphthalen-1-yl)amino]methyl]quinazoline-2,4-diamine;hydrate?
The InChIKey is UTUCDISLEQRRET-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16ClN5.C2H4O2.H2O/c20-15-6-8-16(13-4-2-1-3-12(13)15)23-10-11-5-7-17-14(9-11)18(21)25-19(22)24-17;1-2(3)4;/h1-9,23H,10H2,(H4,21,22,24,25);1H3,(H,3,4);1H2.
What are the key properties of acetic acid;6-[[(4-chloronaphthalen-1-yl)amino]methyl]quinazoline-2,4-diamine;hydrate?
acetic acid;6-[[(4-chloronaphthalen-1-yl)amino]methyl]quinazoline-2,4-diamine;hydrate has a molecular weight of 427.89 g/mol, XLogP of 3.48, 3 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;6-[[(4-chloronaphthalen-1-yl)amino]methyl]quinazoline-2,4-diamine;hydrate is sourced from PubChem (CID 118725297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).