C21H23N3O3S — CID 118725459
N-(2-methyl-5-methylsulfonylphenyl)-1-phenyl-5-propylpyrazole-4-carboxamide (PubChem CID 118725459) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is N-(2-methyl-5-methylsulfonylphenyl)-1-phenyl-5-propylpyrazole-4-carboxamide.
| Compound Name | N-(2-methyl-5-methylsulfonylphenyl)-1-phenyl-5-propylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 118725459 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | N-(2-methyl-5-methylsulfonylphenyl)-1-phenyl-5-propylpyrazole-4-carboxamide |
| SMILES | CCCc1c(C(=O)Nc2cc(S(C)(=O)=O)ccc2C)cnn1-c1ccccc1 |
| InChI | InChI=1S/C21H23N3O3S/c1-4-8-20-18(14-22-24(20)16-9-6-5-7-10-16)21(25)23-19-13-17(28(3,26)27)12-11-15(19)2/h5-7,9-14H,4,8H2,1-3H3,(H,23,25) |
| InChIKey | RKKAYCXPRLGXNH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |