C16H13N5 — CID 118725474
3-[4-(azetidin-1-yl)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]benzonitrile (PubChem CID 118725474) has the molecular formula C16H13N5 and a molecular weight of 275.32 g/mol. Its IUPAC name is 3-[4-(azetidin-1-yl)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]benzonitrile.
| Compound Name | 3-[4-(azetidin-1-yl)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]benzonitrile |
|---|---|
| PubChem CID | 118725474 |
| Molecular Formula | C16H13N5 |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 3-[4-(azetidin-1-yl)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]benzonitrile |
| SMILES | N#Cc1cccc(-c2c[nH]c3ncnc(N4CCC4)c23)c1 |
| InChI | InChI=1S/C16H13N5/c17-8-11-3-1-4-12(7-11)13-9-18-15-14(13)16(20-10-19-15)21-5-2-6-21/h1,3-4,7,9-10H,2,5-6H2,(H,18,19,20) |
| InChIKey | RKFQALUUIOAQIO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 68.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |