C23H37NO3 — CID 118725584
(2R,3S,4S,5R)-1-octyl-4-phenylmethoxy-2-prop-2-enylpiperidine-3,5-diol (PubChem CID 118725584) has the molecular formula C23H37NO3 and a molecular weight of 375.55 g/mol. Its IUPAC name is (2R,3S,4S,5R)-1-octyl-4-phenylmethoxy-2-prop-2-enylpiperidine-3,5-diol.
| Compound Name | (2R,3S,4S,5R)-1-octyl-4-phenylmethoxy-2-prop-2-enylpiperidine-3,5-diol |
|---|---|
| PubChem CID | 118725584 |
| Molecular Formula | C23H37NO3 |
| Molecular Weight | 375.55 g/mol |
| Exact Mass | 375.28 |
| IUPAC Name | (2R,3S,4S,5R)-1-octyl-4-phenylmethoxy-2-prop-2-enylpiperidine-3,5-diol |
| SMILES | C=CC[C@@H]1[C@H](O)[C@@H](OCc2ccccc2)[C@H](O)CN1CCCCCCCC |
| InChI | InChI=1S/C23H37NO3/c1-3-5-6-7-8-12-16-24-17-21(25)23(22(26)20(24)13-4-2)27-18-19-14-10-9-11-15-19/h4,9-11,14-15,20-23,25-26H,2-3,5-8,12-13,16-18H2,1H3/t20-,21-,22+,23+/m1/s1 |
| InChIKey | JNFXERRAGVUJCV-LUKWVAJMSA-N |
| XLogP | 3.91 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.55 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|