C11H23NO3 — CID 118725591
(3R,4S,5S)-5-hexoxypiperidine-3,4-diol (PubChem CID 118725591) has the molecular formula C11H23NO3 and a molecular weight of 217.31 g/mol. Its IUPAC name is (3R,4S,5S)-5-hexoxypiperidine-3,4-diol.
| Compound Name | (3R,4S,5S)-5-hexoxypiperidine-3,4-diol |
|---|---|
| PubChem CID | 118725591 |
| Molecular Formula | C11H23NO3 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.17 |
| IUPAC Name | (3R,4S,5S)-5-hexoxypiperidine-3,4-diol |
| SMILES | CCCCCCO[C@H]1CNC[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H23NO3/c1-2-3-4-5-6-15-10-8-12-7-9(13)11(10)14/h9-14H,2-8H2,1H3/t9-,10+,11+/m1/s1 |
| InChIKey | YLAJZSYMTLQYDO-VWYCJHECSA-N |
| XLogP | 0.28 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|