C8H15NO3 — CID 118725593
(2R,3S,4S,5R)-2-prop-2-enylpiperidine-3,4,5-triol (PubChem CID 118725593) has the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2-prop-2-enylpiperidine-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R)-2-prop-2-enylpiperidine-3,4,5-triol |
|---|---|
| PubChem CID | 118725593 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | (2R,3S,4S,5R)-2-prop-2-enylpiperidine-3,4,5-triol |
| SMILES | C=CC[C@H]1NC[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C8H15NO3/c1-2-3-5-7(11)8(12)6(10)4-9-5/h2,5-12H,1,3-4H2/t5-,6-,7+,8+/m1/s1 |
| InChIKey | WHCAXHJJCMTBKC-NGJRWZKOSA-N |
| XLogP | -1.38 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|