C12H25NO3 — CID 118725596
(2R,3S,4S,5R)-1-butyl-2-propylpiperidine-3,4,5-triol (PubChem CID 118725596) has the molecular formula C12H25NO3 and a molecular weight of 231.34 g/mol. Its IUPAC name is (2R,3S,4S,5R)-1-butyl-2-propylpiperidine-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R)-1-butyl-2-propylpiperidine-3,4,5-triol |
|---|---|
| PubChem CID | 118725596 |
| Molecular Formula | C12H25NO3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | (2R,3S,4S,5R)-1-butyl-2-propylpiperidine-3,4,5-triol |
| SMILES | CCCCN1C[C@@H](O)[C@H](O)[C@@H](O)[C@H]1CCC |
| InChI | InChI=1S/C12H25NO3/c1-3-5-7-13-8-10(14)12(16)11(15)9(13)6-4-2/h9-12,14-16H,3-8H2,1-2H3/t9-,10-,11+,12+/m1/s1 |
| InChIKey | ZXJUXRHGDCJTCU-WYUUTHIRSA-N |
| XLogP | 0.35 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |