C16H33NO3 — CID 118725597
(2R,3S,4S,5R)-1-octyl-2-propylpiperidine-3,4,5-triol (PubChem CID 118725597) has the molecular formula C16H33NO3 and a molecular weight of 287.44 g/mol. Its IUPAC name is (2R,3S,4S,5R)-1-octyl-2-propylpiperidine-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R)-1-octyl-2-propylpiperidine-3,4,5-triol |
|---|---|
| PubChem CID | 118725597 |
| Molecular Formula | C16H33NO3 |
| Molecular Weight | 287.44 g/mol |
| Exact Mass | 287.25 |
| IUPAC Name | (2R,3S,4S,5R)-1-octyl-2-propylpiperidine-3,4,5-triol |
| SMILES | CCCCCCCCN1C[C@@H](O)[C@H](O)[C@@H](O)[C@H]1CCC |
| InChI | InChI=1S/C16H33NO3/c1-3-5-6-7-8-9-11-17-12-14(18)16(20)15(19)13(17)10-4-2/h13-16,18-20H,3-12H2,1-2H3/t13-,14-,15+,16+/m1/s1 |
| InChIKey | MTSGLSSAKHZNHI-WCVJEAGWSA-N |
| XLogP | 1.91 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.44 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|