C23H41NO — CID 118726075
(9Z,12Z)-1-piperidin-1-yloctadeca-9,12-dien-1-one (PubChem CID 118726075) has the molecular formula C23H41NO and a molecular weight of 347.59 g/mol. Its IUPAC name is (9Z,12Z)-1-piperidin-1-yloctadeca-9,12-dien-1-one.
| Compound Name | (9Z,12Z)-1-piperidin-1-yloctadeca-9,12-dien-1-one |
|---|---|
| PubChem CID | 118726075 |
| Molecular Formula | C23H41NO |
| Molecular Weight | 347.59 g/mol |
| Exact Mass | 347.32 |
| IUPAC Name | (9Z,12Z)-1-piperidin-1-yloctadeca-9,12-dien-1-one |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)N1CCCCC1 |
| InChI | InChI=1S/C23H41NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-17-20-23(25)24-21-18-16-19-22-24/h6-7,9-10H,2-5,8,11-22H2,1H3/b7-6-,10-9- |
| InChIKey | UQQYNIWNANGMEW-HZJYTTRNSA-N |
| XLogP | 6.81 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.59 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|