C14H10N4O — CID 118726130
13-methyl-2,12,16,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11,13-heptaen-15-one (PubChem CID 118726130) has the molecular formula C14H10N4O and a molecular weight of 250.26 g/mol. Its IUPAC name is 13-methyl-2,12,16,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11,13-heptaen-15-one.
| Compound Name | 13-methyl-2,12,16,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11,13-heptaen-15-one |
|---|---|
| PubChem CID | 118726130 |
| Molecular Formula | C14H10N4O |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 13-methyl-2,12,16,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11,13-heptaen-15-one |
| SMILES | Cc1cc(=O)n2[nH]c3nc4ccccc4cc3c2n1 |
| InChI | InChI=1S/C14H10N4O/c1-8-6-12(19)18-14(15-8)10-7-9-4-2-3-5-11(9)16-13(10)17-18/h2-7H,1H3,(H,16,17) |
| InChIKey | LPRNNRLSCARCCR-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |