C14H9ClN4 — CID 118726131
15-chloro-13-methyl-2,12,16,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(17),2,4,6,8,10,12,14-octaene (PubChem CID 118726131) has the molecular formula C14H9ClN4 and a molecular weight of 268.71 g/mol. Its IUPAC name is 15-chloro-13-methyl-2,12,16,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(17),2,4,6,8,10,12,14-octaene.
| Compound Name | 15-chloro-13-methyl-2,12,16,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(17),2,4,6,8,10,12,14-octaene |
|---|---|
| PubChem CID | 118726131 |
| Molecular Formula | C14H9ClN4 |
| Molecular Weight | 268.71 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 15-chloro-13-methyl-2,12,16,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(17),2,4,6,8,10,12,14-octaene |
| SMILES | Cc1cc(Cl)n2nc3nc4ccccc4cc3c2n1 |
| InChI | InChI=1S/C14H9ClN4/c1-8-6-12(15)19-14(16-8)10-7-9-4-2-3-5-11(9)17-13(10)18-19/h2-7H,1H3 |
| InChIKey | WJSORSXXYUOSNJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.71 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |