About 6-phenyl-4-(3,4,5-trimethoxyphenyl)-2H-chromene
6-phenyl-4-(3,4,5-trimethoxyphenyl)-2H-chromene (PubChem CID 118726859) has the molecular formula C24H22O4
and a molecular weight of 374.44 g/mol. Its IUPAC name is 6-phenyl-4-(3,4,5-trimethoxyphenyl)-2H-chromene.
Molecular Properties
| Compound Name | 6-phenyl-4-(3,4,5-trimethoxyphenyl)-2H-chromene |
| PubChem CID | 118726859 |
| Molecular Formula | C24H22O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 6-phenyl-4-(3,4,5-trimethoxyphenyl)-2H-chromene |
| SMILES | COc1cc(C2=CCOc3ccc(-c4ccccc4)cc32)cc(OC)c1OC |
| InChI | InChI=1S/C24H22O4/c1-25-22-14-18(15-23(26-2)24(22)27-3)19-11-12-28-21-10-9-17(13-20(19)21)16-7-5-4-6-8-16/h4-11,13-15H,12H2,1-3H3 |
| InChIKey | ZUVBEQREOYUQTM-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-phenyl-4-(3,4,5-trimethoxyphenyl)-2H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-phenyl-4-(3,4,5-trimethoxyphenyl)-2H-chromene?
The IUPAC name of 6-phenyl-4-(3,4,5-trimethoxyphenyl)-2H-chromene (CID 118726859) is 6-phenyl-4-(3,4,5-trimethoxyphenyl)-2H-chromene.
What is the SMILES notation for 6-phenyl-4-(3,4,5-trimethoxyphenyl)-2H-chromene?
The canonical SMILES for 6-phenyl-4-(3,4,5-trimethoxyphenyl)-2H-chromene is COc1cc(C2=CCOc3ccc(-c4ccccc4)cc32)cc(OC)c1OC.
What is the InChIKey of 6-phenyl-4-(3,4,5-trimethoxyphenyl)-2H-chromene?
The InChIKey is ZUVBEQREOYUQTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22O4/c1-25-22-14-18(15-23(26-2)24(22)27-3)19-11-12-28-21-10-9-17(13-20(19)21)16-7-5-4-6-8-16/h4-11,13-15H,12H2,1-3H3.
What are the key properties of 6-phenyl-4-(3,4,5-trimethoxyphenyl)-2H-chromene?
6-phenyl-4-(3,4,5-trimethoxyphenyl)-2H-chromene has a molecular weight of 374.44 g/mol, XLogP of 5.20, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phenyl-4-(3,4,5-trimethoxyphenyl)-2H-chromene is sourced from PubChem (CID 118726859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).