C19H23NO5 — CID 118726864
7-methoxy-4-(3,4,5-trimethoxyphenyl)-3,4-dihydro-2H-chromen-8-amine (PubChem CID 118726864) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is 7-methoxy-4-(3,4,5-trimethoxyphenyl)-3,4-dihydro-2H-chromen-8-amine.
| Compound Name | 7-methoxy-4-(3,4,5-trimethoxyphenyl)-3,4-dihydro-2H-chromen-8-amine |
|---|---|
| PubChem CID | 118726864 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 7-methoxy-4-(3,4,5-trimethoxyphenyl)-3,4-dihydro-2H-chromen-8-amine |
| SMILES | COc1ccc2c(c1N)OCCC2c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C19H23NO5/c1-21-14-6-5-13-12(7-8-25-18(13)17(14)20)11-9-15(22-2)19(24-4)16(10-11)23-3/h5-6,9-10,12H,7-8,20H2,1-4H3 |
| InChIKey | QWBPKZQCCISJKH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|