C25H34NO7P — CID 118727036
cyclohexyl (2S)-2-[[[(3S,4R)-3-hydroxy-4-(hydroxymethyl)cyclopentyl]oxy-naphthalen-1-yloxyphosphoryl]amino]propanoate (PubChem CID 118727036) has the molecular formula C25H34NO7P and a molecular weight of 491.52 g/mol. Its IUPAC name is cyclohexyl (2S)-2-[[[(3S,4R)-3-hydroxy-4-(hydroxymethyl)cyclopentyl]oxy-naphthalen-1-yloxyphosphoryl]amino]propanoate.
| Compound Name | cyclohexyl (2S)-2-[[[(3S,4R)-3-hydroxy-4-(hydroxymethyl)cyclopentyl]oxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 118727036 |
| Molecular Formula | C25H34NO7P |
| Molecular Weight | 491.52 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | cyclohexyl (2S)-2-[[[(3S,4R)-3-hydroxy-4-(hydroxymethyl)cyclopentyl]oxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
| SMILES | C[C@H](NP(=O)(Oc1cccc2ccccc12)OC1C[C@H](CO)[C@@H](O)C1)C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C25H34NO7P/c1-17(25(29)31-20-10-3-2-4-11-20)26-34(30,32-21-14-19(16-27)23(28)15-21)33-24-13-7-9-18-8-5-6-12-22(18)24/h5-9,12-13,17,19-21,23,27-28H,2-4,10-11,14-16H2,1H3,(H,26,30)/t17-,19+,21?,23-,34?/m0/s1 |
| InChIKey | DKKYUOFNPCKNII-BGIOVXKWSA-N |
| XLogP | 4.33 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.52 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|