About cis-(3S,4R)-4-(hydroxymethyl)cyclopentane-1,3-diol
cis-(3S,4R)-4-(hydroxymethyl)cyclopentane-1,3-diol (PubChem CID 118727041) has the molecular formula C6H12O3
and a molecular weight of 132.16 g/mol. Its IUPAC name is cis-(3S,4R)-4-(hydroxymethyl)cyclopentane-1,3-diol.
Molecular Properties
| Compound Name | cis-(3S,4R)-4-(hydroxymethyl)cyclopentane-1,3-diol |
| PubChem CID | 118727041 |
| Molecular Formula | C6H12O3 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | cis-(3S,4R)-4-(hydroxymethyl)cyclopentane-1,3-diol |
| SMILES | OC[C@H]1CC(O)C[C@@H]1O |
| InChI | InChI=1S/C6H12O3/c7-3-4-1-5(8)2-6(4)9/h4-9H,1-3H2/t4-,5?,6+/m1/s1 |
| InChIKey | HXUPUZHHZBLALZ-QBQQJPCDSA-N |
| XLogP | -0.89 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cis-(3S,4R)-4-(hydroxymethyl)cyclopentane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(3S,4R)-4-(hydroxymethyl)cyclopentane-1,3-diol?
The IUPAC name of cis-(3S,4R)-4-(hydroxymethyl)cyclopentane-1,3-diol (CID 118727041) is cis-(3S,4R)-4-(hydroxymethyl)cyclopentane-1,3-diol.
What is the SMILES notation for cis-(3S,4R)-4-(hydroxymethyl)cyclopentane-1,3-diol?
The canonical SMILES for cis-(3S,4R)-4-(hydroxymethyl)cyclopentane-1,3-diol is OC[C@H]1CC(O)C[C@@H]1O.
What is the InChIKey of cis-(3S,4R)-4-(hydroxymethyl)cyclopentane-1,3-diol?
The InChIKey is HXUPUZHHZBLALZ-QBQQJPCDSA-N. The full InChI is InChI=1S/C6H12O3/c7-3-4-1-5(8)2-6(4)9/h4-9H,1-3H2/t4-,5?,6+/m1/s1.
What are the key properties of cis-(3S,4R)-4-(hydroxymethyl)cyclopentane-1,3-diol?
cis-(3S,4R)-4-(hydroxymethyl)cyclopentane-1,3-diol has a molecular weight of 132.16 g/mol, XLogP of -0.89, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(3S,4R)-4-(hydroxymethyl)cyclopentane-1,3-diol is sourced from PubChem (CID 118727041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).