C22H19N5O2 — CID 118727280
3-(1-butylindol-3-yl)-4-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pyrrole-2,5-dione (PubChem CID 118727280) has the molecular formula C22H19N5O2 and a molecular weight of 385.43 g/mol. Its IUPAC name is 3-(1-butylindol-3-yl)-4-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-(1-butylindol-3-yl)-4-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 118727280 |
| Molecular Formula | C22H19N5O2 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 3-(1-butylindol-3-yl)-4-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pyrrole-2,5-dione |
| SMILES | CCCCn1cc(C2=C(c3nnc4ccccn34)C(=O)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C22H19N5O2/c1-2-3-11-26-13-15(14-8-4-5-9-16(14)26)18-19(22(29)23-21(18)28)20-25-24-17-10-6-7-12-27(17)20/h4-10,12-13H,2-3,11H2,1H3,(H,23,28,29) |
| InChIKey | PDEMGOQKRKZNLG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|