C25H24N6O3 — CID 118727284
3-[1-(3-morpholin-4-ylpropyl)indol-3-yl]-4-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pyrrole-2,5-dione (PubChem CID 118727284) has the molecular formula C25H24N6O3 and a molecular weight of 456.51 g/mol. Its IUPAC name is 3-[1-(3-morpholin-4-ylpropyl)indol-3-yl]-4-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[1-(3-morpholin-4-ylpropyl)indol-3-yl]-4-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 118727284 |
| Molecular Formula | C25H24N6O3 |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | 3-[1-(3-morpholin-4-ylpropyl)indol-3-yl]-4-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2nnc3ccccn23)=C1c1cn(CCCN2CCOCC2)c2ccccc12 |
| InChI | InChI=1S/C25H24N6O3/c32-24-21(22(25(33)26-24)23-28-27-20-8-3-4-11-31(20)23)18-16-30(19-7-2-1-6-17(18)19)10-5-9-29-12-14-34-15-13-29/h1-4,6-8,11,16H,5,9-10,12-15H2,(H,26,32,33) |
| InChIKey | NHBBJBOGWGWTRG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 93.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|