C6H6ClNS5 — CID 118727323
1,2,3,4,5-benzopentathiepin-6-amine;hydrochloride (PubChem CID 118727323) has the molecular formula C6H6ClNS5 and a molecular weight of 287.91 g/mol. Its IUPAC name is 1,2,3,4,5-benzopentathiepin-6-amine;hydrochloride.
| Compound Name | 1,2,3,4,5-benzopentathiepin-6-amine;hydrochloride |
|---|---|
| PubChem CID | 118727323 |
| Molecular Formula | C6H6ClNS5 |
| Molecular Weight | 287.91 g/mol |
| Exact Mass | 286.88 |
| IUPAC Name | 1,2,3,4,5-benzopentathiepin-6-amine;hydrochloride |
| SMILES | Cl.Nc1cccc2c1SSSSS2 |
| InChI | InChI=1S/C6H5NS5.ClH/c7-4-2-1-3-5-6(4)9-11-12-10-8-5;/h1-3H,7H2;1H |
| InChIKey | LVDPHZGWBBUPCT-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.91 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|