About 2-(1,3-diphenylpyrazol-4-yl)-4-(4-methoxyphenyl)-1,3-thiazole-5-carboxylic acid
2-(1,3-diphenylpyrazol-4-yl)-4-(4-methoxyphenyl)-1,3-thiazole-5-carboxylic acid (PubChem CID 118727568) has the molecular formula C26H19N3O3S
and a molecular weight of 453.52 g/mol. Its IUPAC name is 2-(1,3-diphenylpyrazol-4-yl)-4-(4-methoxyphenyl)-1,3-thiazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-(1,3-diphenylpyrazol-4-yl)-4-(4-methoxyphenyl)-1,3-thiazole-5-carboxylic acid |
| PubChem CID | 118727568 |
| Molecular Formula | C26H19N3O3S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | 2-(1,3-diphenylpyrazol-4-yl)-4-(4-methoxyphenyl)-1,3-thiazole-5-carboxylic acid |
| SMILES | COc1ccc(-c2nc(-c3cn(-c4ccccc4)nc3-c3ccccc3)sc2C(=O)O)cc1 |
| InChI | InChI=1S/C26H19N3O3S/c1-32-20-14-12-18(13-15-20)23-24(26(30)31)33-25(27-23)21-16-29(19-10-6-3-7-11-19)28-22(21)17-8-4-2-5-9-17/h2-16H,1H3,(H,30,31) |
| InChIKey | YEGMQUZPLGLTEV-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(1,3-diphenylpyrazol-4-yl)-4-(4-methoxyphenyl)-1,3-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-diphenylpyrazol-4-yl)-4-(4-methoxyphenyl)-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-(1,3-diphenylpyrazol-4-yl)-4-(4-methoxyphenyl)-1,3-thiazole-5-carboxylic acid (CID 118727568) is 2-(1,3-diphenylpyrazol-4-yl)-4-(4-methoxyphenyl)-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-(1,3-diphenylpyrazol-4-yl)-4-(4-methoxyphenyl)-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-(1,3-diphenylpyrazol-4-yl)-4-(4-methoxyphenyl)-1,3-thiazole-5-carboxylic acid is COc1ccc(-c2nc(-c3cn(-c4ccccc4)nc3-c3ccccc3)sc2C(=O)O)cc1.
What is the InChIKey of 2-(1,3-diphenylpyrazol-4-yl)-4-(4-methoxyphenyl)-1,3-thiazole-5-carboxylic acid?
The InChIKey is YEGMQUZPLGLTEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H19N3O3S/c1-32-20-14-12-18(13-15-20)23-24(26(30)31)33-25(27-23)21-16-29(19-10-6-3-7-11-19)28-22(21)17-8-4-2-5-9-17/h2-16H,1H3,(H,30,31).
What are the key properties of 2-(1,3-diphenylpyrazol-4-yl)-4-(4-methoxyphenyl)-1,3-thiazole-5-carboxylic acid?
2-(1,3-diphenylpyrazol-4-yl)-4-(4-methoxyphenyl)-1,3-thiazole-5-carboxylic acid has a molecular weight of 453.52 g/mol, XLogP of 6.04, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-diphenylpyrazol-4-yl)-4-(4-methoxyphenyl)-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 118727568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).