About 1-[4-[4-(2,4-difluorophenyl)piperazin-1-yl]butyl]pyrrolidin-2-one;hydrochloride
1-[4-[4-(2,4-difluorophenyl)piperazin-1-yl]butyl]pyrrolidin-2-one;hydrochloride (PubChem CID 118727913) has the molecular formula C18H26ClF2N3O
and a molecular weight of 373.88 g/mol. Its IUPAC name is 1-[4-[4-(2,4-difluorophenyl)piperazin-1-yl]butyl]pyrrolidin-2-one;hydrochloride.
Molecular Properties
| Compound Name | 1-[4-[4-(2,4-difluorophenyl)piperazin-1-yl]butyl]pyrrolidin-2-one;hydrochloride |
| PubChem CID | 118727913 |
| Molecular Formula | C18H26ClF2N3O |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 1-[4-[4-(2,4-difluorophenyl)piperazin-1-yl]butyl]pyrrolidin-2-one;hydrochloride |
| SMILES | Cl.O=C1CCCN1CCCCN1CCN(c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C18H25F2N3O.ClH/c19-15-5-6-17(16(20)14-15)22-12-10-21(11-13-22)7-1-2-8-23-9-3-4-18(23)24;/h5-6,14H,1-4,7-13H2;1H |
| InChIKey | BYFPUJBOVOWOEM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-[4-(2,4-difluorophenyl)piperazin-1-yl]butyl]pyrrolidin-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[4-(2,4-difluorophenyl)piperazin-1-yl]butyl]pyrrolidin-2-one;hydrochloride?
The IUPAC name of 1-[4-[4-(2,4-difluorophenyl)piperazin-1-yl]butyl]pyrrolidin-2-one;hydrochloride (CID 118727913) is 1-[4-[4-(2,4-difluorophenyl)piperazin-1-yl]butyl]pyrrolidin-2-one;hydrochloride.
What is the SMILES notation for 1-[4-[4-(2,4-difluorophenyl)piperazin-1-yl]butyl]pyrrolidin-2-one;hydrochloride?
The canonical SMILES for 1-[4-[4-(2,4-difluorophenyl)piperazin-1-yl]butyl]pyrrolidin-2-one;hydrochloride is Cl.O=C1CCCN1CCCCN1CCN(c2ccc(F)cc2F)CC1.
What is the InChIKey of 1-[4-[4-(2,4-difluorophenyl)piperazin-1-yl]butyl]pyrrolidin-2-one;hydrochloride?
The InChIKey is BYFPUJBOVOWOEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25F2N3O.ClH/c19-15-5-6-17(16(20)14-15)22-12-10-21(11-13-22)7-1-2-8-23-9-3-4-18(23)24;/h5-6,14H,1-4,7-13H2;1H.
What are the key properties of 1-[4-[4-(2,4-difluorophenyl)piperazin-1-yl]butyl]pyrrolidin-2-one;hydrochloride?
1-[4-[4-(2,4-difluorophenyl)piperazin-1-yl]butyl]pyrrolidin-2-one;hydrochloride has a molecular weight of 373.88 g/mol, XLogP of 2.91, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[4-(2,4-difluorophenyl)piperazin-1-yl]butyl]pyrrolidin-2-one;hydrochloride is sourced from PubChem (CID 118727913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).