C30H40N4O3S — CID 118727925
N-[4-[2-[[5-cyano-8-(2,6-dimethylmorpholin-4-yl)-3,3-dimethyl-1,4-dihydropyrano[3,4-c]pyridin-6-yl]sulfanyl]ethyl]phenyl]-2,2-dimethylpropanamide (PubChem CID 118727925) has the molecular formula C30H40N4O3S and a molecular weight of 536.74 g/mol. Its IUPAC name is N-[4-[2-[[5-cyano-8-(2,6-dimethylmorpholin-4-yl)-3,3-dimethyl-1,4-dihydropyrano[3,4-c]pyridin-6-yl]sulfanyl]ethyl]phenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[4-[2-[[5-cyano-8-(2,6-dimethylmorpholin-4-yl)-3,3-dimethyl-1,4-dihydropyrano[3,4-c]pyridin-6-yl]sulfanyl]ethyl]phenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 118727925 |
| Molecular Formula | C30H40N4O3S |
| Molecular Weight | 536.74 g/mol |
| Exact Mass | 536.28 |
| IUPAC Name | N-[4-[2-[[5-cyano-8-(2,6-dimethylmorpholin-4-yl)-3,3-dimethyl-1,4-dihydropyrano[3,4-c]pyridin-6-yl]sulfanyl]ethyl]phenyl]-2,2-dimethylpropanamide |
| SMILES | CC1CN(c2nc(SCCc3ccc(NC(=O)C(C)(C)C)cc3)c(C#N)c3c2COC(C)(C)C3)CC(C)O1 |
| InChI | InChI=1S/C30H40N4O3S/c1-19-16-34(17-20(2)37-19)26-25-18-36-30(6,7)14-23(25)24(15-31)27(33-26)38-13-12-21-8-10-22(11-9-21)32-28(35)29(3,4)5/h8-11,19-20H,12-14,16-18H2,1-7H3,(H,32,35) |
| InChIKey | DCZMBECPVAEZMF-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 87.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.74 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |