About 4-[(2-pyrrolidin-2-ylacetyl)amino]-N-(1,3-thiazol-2-yl)benzamide
4-[(2-pyrrolidin-2-ylacetyl)amino]-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 118728364) has the molecular formula C16H18N4O2S
and a molecular weight of 330.41 g/mol. Its IUPAC name is 4-[(2-pyrrolidin-2-ylacetyl)amino]-N-(1,3-thiazol-2-yl)benzamide.
Molecular Properties
| Compound Name | 4-[(2-pyrrolidin-2-ylacetyl)amino]-N-(1,3-thiazol-2-yl)benzamide |
| PubChem CID | 118728364 |
| Molecular Formula | C16H18N4O2S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 4-[(2-pyrrolidin-2-ylacetyl)amino]-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | O=C(CC1CCCN1)Nc1ccc(C(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C16H18N4O2S/c21-14(10-13-2-1-7-17-13)19-12-5-3-11(4-6-12)15(22)20-16-18-8-9-23-16/h3-6,8-9,13,17H,1-2,7,10H2,(H,19,21)(H,18,20,22) |
| InChIKey | CPCOVXCUVCIEEO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(2-pyrrolidin-2-ylacetyl)amino]-N-(1,3-thiazol-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-pyrrolidin-2-ylacetyl)amino]-N-(1,3-thiazol-2-yl)benzamide?
The IUPAC name of 4-[(2-pyrrolidin-2-ylacetyl)amino]-N-(1,3-thiazol-2-yl)benzamide (CID 118728364) is 4-[(2-pyrrolidin-2-ylacetyl)amino]-N-(1,3-thiazol-2-yl)benzamide.
What is the SMILES notation for 4-[(2-pyrrolidin-2-ylacetyl)amino]-N-(1,3-thiazol-2-yl)benzamide?
The canonical SMILES for 4-[(2-pyrrolidin-2-ylacetyl)amino]-N-(1,3-thiazol-2-yl)benzamide is O=C(CC1CCCN1)Nc1ccc(C(=O)Nc2nccs2)cc1.
What is the InChIKey of 4-[(2-pyrrolidin-2-ylacetyl)amino]-N-(1,3-thiazol-2-yl)benzamide?
The InChIKey is CPCOVXCUVCIEEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N4O2S/c21-14(10-13-2-1-7-17-13)19-12-5-3-11(4-6-12)15(22)20-16-18-8-9-23-16/h3-6,8-9,13,17H,1-2,7,10H2,(H,19,21)(H,18,20,22).
What are the key properties of 4-[(2-pyrrolidin-2-ylacetyl)amino]-N-(1,3-thiazol-2-yl)benzamide?
4-[(2-pyrrolidin-2-ylacetyl)amino]-N-(1,3-thiazol-2-yl)benzamide has a molecular weight of 330.41 g/mol, XLogP of 2.48, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-pyrrolidin-2-ylacetyl)amino]-N-(1,3-thiazol-2-yl)benzamide is sourced from PubChem (CID 118728364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).