About 7,8-bis(4-chlorophenyl)-N,N-dimethyl-2-azabicyclo[3.2.2]nonan-5-amine;hydrochloride
7,8-bis(4-chlorophenyl)-N,N-dimethyl-2-azabicyclo[3.2.2]nonan-5-amine;hydrochloride (PubChem CID 118728463) has the molecular formula C22H27Cl3N2
and a molecular weight of 425.83 g/mol. Its IUPAC name is 7,8-bis(4-chlorophenyl)-N,N-dimethyl-2-azabicyclo[3.2.2]nonan-5-amine;hydrochloride.
Molecular Properties
| Compound Name | 7,8-bis(4-chlorophenyl)-N,N-dimethyl-2-azabicyclo[3.2.2]nonan-5-amine;hydrochloride |
| PubChem CID | 118728463 |
| Molecular Formula | C22H27Cl3N2 |
| Molecular Weight | 425.83 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 7,8-bis(4-chlorophenyl)-N,N-dimethyl-2-azabicyclo[3.2.2]nonan-5-amine;hydrochloride |
| SMILES | CN(C)C12CCNC(C(c3ccc(Cl)cc3)C1)C(c1ccc(Cl)cc1)C2.Cl |
| InChI | InChI=1S/C22H26Cl2N2.ClH/c1-26(2)22-11-12-25-21(19(13-22)15-3-7-17(23)8-4-15)20(14-22)16-5-9-18(24)10-6-16;/h3-10,19-21,25H,11-14H2,1-2H3;1H |
| InChIKey | CPVBPDLVWGUTME-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.83 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7,8-bis(4-chlorophenyl)-N,N-dimethyl-2-azabicyclo[3.2.2]nonan-5-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-bis(4-chlorophenyl)-N,N-dimethyl-2-azabicyclo[3.2.2]nonan-5-amine;hydrochloride?
The IUPAC name of 7,8-bis(4-chlorophenyl)-N,N-dimethyl-2-azabicyclo[3.2.2]nonan-5-amine;hydrochloride (CID 118728463) is 7,8-bis(4-chlorophenyl)-N,N-dimethyl-2-azabicyclo[3.2.2]nonan-5-amine;hydrochloride.
What is the SMILES notation for 7,8-bis(4-chlorophenyl)-N,N-dimethyl-2-azabicyclo[3.2.2]nonan-5-amine;hydrochloride?
The canonical SMILES for 7,8-bis(4-chlorophenyl)-N,N-dimethyl-2-azabicyclo[3.2.2]nonan-5-amine;hydrochloride is CN(C)C12CCNC(C(c3ccc(Cl)cc3)C1)C(c1ccc(Cl)cc1)C2.Cl.
What is the InChIKey of 7,8-bis(4-chlorophenyl)-N,N-dimethyl-2-azabicyclo[3.2.2]nonan-5-amine;hydrochloride?
The InChIKey is CPVBPDLVWGUTME-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26Cl2N2.ClH/c1-26(2)22-11-12-25-21(19(13-22)15-3-7-17(23)8-4-15)20(14-22)16-5-9-18(24)10-6-16;/h3-10,19-21,25H,11-14H2,1-2H3;1H.
What are the key properties of 7,8-bis(4-chlorophenyl)-N,N-dimethyl-2-azabicyclo[3.2.2]nonan-5-amine;hydrochloride?
7,8-bis(4-chlorophenyl)-N,N-dimethyl-2-azabicyclo[3.2.2]nonan-5-amine;hydrochloride has a molecular weight of 425.83 g/mol, XLogP of 5.74, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-bis(4-chlorophenyl)-N,N-dimethyl-2-azabicyclo[3.2.2]nonan-5-amine;hydrochloride is sourced from PubChem (CID 118728463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).