C34H45N5O4 — CID 118728496
2-[6-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)hexylamino]-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)benzamide (PubChem CID 118728496) has the molecular formula C34H45N5O4 and a molecular weight of 587.77 g/mol. Its IUPAC name is 2-[6-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)hexylamino]-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)benzamide.
| Compound Name | 2-[6-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)hexylamino]-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)benzamide |
|---|---|
| PubChem CID | 118728496 |
| Molecular Formula | C34H45N5O4 |
| Molecular Weight | 587.77 g/mol |
| Exact Mass | 587.35 |
| IUPAC Name | 2-[6-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)hexylamino]-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)benzamide |
| SMILES | COc1cc2c(cc1OC)CN(CCCCCCNc1cc(-n3nc(C)c4c3CC(C)(C)CC4=O)ccc1C(N)=O)CC2 |
| InChI | InChI=1S/C34H45N5O4/c1-22-32-28(19-34(2,3)20-29(32)40)39(37-22)25-10-11-26(33(35)41)27(18-25)36-13-8-6-7-9-14-38-15-12-23-16-30(42-4)31(43-5)17-24(23)21-38/h10-11,16-18,36H,6-9,12-15,19-21H2,1-5H3,(H2,35,41) |
| InChIKey | MIKYLDUBUPGRFI-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.77 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|