C21H25N3O — CID 118728607
N-[(2R,3S)-2,3-diphenylcyclopropyl]-4-methylpiperazine-1-carboxamide (PubChem CID 118728607) has the molecular formula C21H25N3O and a molecular weight of 335.45 g/mol. Its IUPAC name is N-[(2R,3S)-2,3-diphenylcyclopropyl]-4-methylpiperazine-1-carboxamide.
| Compound Name | N-[(2R,3S)-2,3-diphenylcyclopropyl]-4-methylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 118728607 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | N-[(2R,3S)-2,3-diphenylcyclopropyl]-4-methylpiperazine-1-carboxamide |
| SMILES | CN1CCN(C(=O)NC2[C@@H](c3ccccc3)[C@H]2c2ccccc2)CC1 |
| InChI | InChI=1S/C21H25N3O/c1-23-12-14-24(15-13-23)21(25)22-20-18(16-8-4-2-5-9-16)19(20)17-10-6-3-7-11-17/h2-11,18-20H,12-15H2,1H3,(H,22,25)/t18-,19+,20? |
| InChIKey | LEQRENHIKQQYRF-YOFSQIOKSA-N |
| XLogP | 2.89 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |