About N'-(7-chloroquinolin-4-yl)-N-[(5-pyridin-3-ylthiophen-2-yl)methyl]ethane-1,2-diamine
N'-(7-chloroquinolin-4-yl)-N-[(5-pyridin-3-ylthiophen-2-yl)methyl]ethane-1,2-diamine (PubChem CID 118728634) has the molecular formula C21H19ClN4S
and a molecular weight of 394.93 g/mol. Its IUPAC name is N'-(7-chloroquinolin-4-yl)-N-[(5-pyridin-3-ylthiophen-2-yl)methyl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(7-chloroquinolin-4-yl)-N-[(5-pyridin-3-ylthiophen-2-yl)methyl]ethane-1,2-diamine |
| PubChem CID | 118728634 |
| Molecular Formula | C21H19ClN4S |
| Molecular Weight | 394.93 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | N'-(7-chloroquinolin-4-yl)-N-[(5-pyridin-3-ylthiophen-2-yl)methyl]ethane-1,2-diamine |
| SMILES | Clc1ccc2c(NCCNCc3ccc(-c4cccnc4)s3)ccnc2c1 |
| InChI | InChI=1S/C21H19ClN4S/c22-16-3-5-18-19(7-9-25-20(18)12-16)26-11-10-24-14-17-4-6-21(27-17)15-2-1-8-23-13-15/h1-9,12-13,24H,10-11,14H2,(H,25,26) |
| InChIKey | AOWDYHCQPDUITK-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.93 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-(7-chloroquinolin-4-yl)-N-[(5-pyridin-3-ylthiophen-2-yl)methyl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(7-chloroquinolin-4-yl)-N-[(5-pyridin-3-ylthiophen-2-yl)methyl]ethane-1,2-diamine?
The IUPAC name of N'-(7-chloroquinolin-4-yl)-N-[(5-pyridin-3-ylthiophen-2-yl)methyl]ethane-1,2-diamine (CID 118728634) is N'-(7-chloroquinolin-4-yl)-N-[(5-pyridin-3-ylthiophen-2-yl)methyl]ethane-1,2-diamine.
What is the SMILES notation for N'-(7-chloroquinolin-4-yl)-N-[(5-pyridin-3-ylthiophen-2-yl)methyl]ethane-1,2-diamine?
The canonical SMILES for N'-(7-chloroquinolin-4-yl)-N-[(5-pyridin-3-ylthiophen-2-yl)methyl]ethane-1,2-diamine is Clc1ccc2c(NCCNCc3ccc(-c4cccnc4)s3)ccnc2c1.
What is the InChIKey of N'-(7-chloroquinolin-4-yl)-N-[(5-pyridin-3-ylthiophen-2-yl)methyl]ethane-1,2-diamine?
The InChIKey is AOWDYHCQPDUITK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19ClN4S/c22-16-3-5-18-19(7-9-25-20(18)12-16)26-11-10-24-14-17-4-6-21(27-17)15-2-1-8-23-13-15/h1-9,12-13,24H,10-11,14H2,(H,25,26).
What are the key properties of N'-(7-chloroquinolin-4-yl)-N-[(5-pyridin-3-ylthiophen-2-yl)methyl]ethane-1,2-diamine?
N'-(7-chloroquinolin-4-yl)-N-[(5-pyridin-3-ylthiophen-2-yl)methyl]ethane-1,2-diamine has a molecular weight of 394.93 g/mol, XLogP of 5.21, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(7-chloroquinolin-4-yl)-N-[(5-pyridin-3-ylthiophen-2-yl)methyl]ethane-1,2-diamine is sourced from PubChem (CID 118728634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).