C28H26N2O4S3 — CID 118728675
(2S,3S)-N-(benzenesulfonyl)-3-methyl-2-[(5Z)-4-oxo-5-[(4-phenylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanamide (PubChem CID 118728675) has the molecular formula C28H26N2O4S3 and a molecular weight of 550.73 g/mol. Its IUPAC name is (2S,3S)-N-(benzenesulfonyl)-3-methyl-2-[(5Z)-4-oxo-5-[(4-phenylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanamide.
| Compound Name | (2S,3S)-N-(benzenesulfonyl)-3-methyl-2-[(5Z)-4-oxo-5-[(4-phenylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanamide |
|---|---|
| PubChem CID | 118728675 |
| Molecular Formula | C28H26N2O4S3 |
| Molecular Weight | 550.73 g/mol |
| Exact Mass | 550.11 |
| IUPAC Name | (2S,3S)-N-(benzenesulfonyl)-3-methyl-2-[(5Z)-4-oxo-5-[(4-phenylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanamide |
| SMILES | CC[C@H](C)[C@@H](C(=O)NS(=O)(=O)c1ccccc1)N1C(=O)/C(=C/c2ccc(-c3ccccc3)cc2)SC1=S |
| InChI | InChI=1S/C28H26N2O4S3/c1-3-19(2)25(26(31)29-37(33,34)23-12-8-5-9-13-23)30-27(32)24(36-28(30)35)18-20-14-16-22(17-15-20)21-10-6-4-7-11-21/h4-19,25H,3H2,1-2H3,(H,29,31)/b24-18-/t19-,25-/m0/s1 |
| InChIKey | XLIXBBVJVMZVOY-QDVLEVAKSA-N |
| XLogP | 5.47 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.73 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|