C28H27IN4O3 — CID 118728871
(1S,12R,15R,23R)-16-acetyl-7-iodo-12-methyl-23-(2-methylbut-3-en-2-yl)-3,11,14,16-tetrazahexacyclo[12.10.0.02,11.04,9.015,23.017,22]tetracosa-2,4(9),5,7,17,19,21-heptaene-10,13-dione (PubChem CID 118728871) has the molecular formula C28H27IN4O3 and a molecular weight of 594.45 g/mol. Its IUPAC name is (1S,12R,15R,23R)-16-acetyl-7-iodo-12-methyl-23-(2-methylbut-3-en-2-yl)-3,11,14,16-tetrazahexacyclo[12.10.0.02,11.04,9.015,23.017,22]tetracosa-2,4(9),5,7,17,19,21-heptaene-10,13-dione.
| Compound Name | (1S,12R,15R,23R)-16-acetyl-7-iodo-12-methyl-23-(2-methylbut-3-en-2-yl)-3,11,14,16-tetrazahexacyclo[12.10.0.02,11.04,9.015,23.017,22]tetracosa-2,4(9),5,7,17,19,21-heptaene-10,13-dione |
|---|---|
| PubChem CID | 118728871 |
| Molecular Formula | C28H27IN4O3 |
| Molecular Weight | 594.45 g/mol |
| Exact Mass | 594.11 |
| IUPAC Name | (1S,12R,15R,23R)-16-acetyl-7-iodo-12-methyl-23-(2-methylbut-3-en-2-yl)-3,11,14,16-tetrazahexacyclo[12.10.0.02,11.04,9.015,23.017,22]tetracosa-2,4(9),5,7,17,19,21-heptaene-10,13-dione |
| SMILES | C=CC(C)(C)[C@@]12C[C@H]3c4nc5ccc(I)cc5c(=O)n4[C@H](C)C(=O)N3[C@@H]1N(C(C)=O)c1ccccc12 |
| InChI | InChI=1S/C28H27IN4O3/c1-6-27(4,5)28-14-22-23-30-20-12-11-17(29)13-18(20)25(36)31(23)15(2)24(35)33(22)26(28)32(16(3)34)21-10-8-7-9-19(21)28/h6-13,15,22,26H,1,14H2,2-5H3/t15-,22+,26+,28-/m1/s1 |
| InChIKey | JIVOJRIYZBKAGN-XFIXFYESSA-N |
| XLogP | 4.69 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.45 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|