C44H32N4 — CID 118729008
(4Z,10Z,15Z,19Z)-5,10,15,20-tetraphenyl-1,9,21,24-tetrahydroporphyrin (PubChem CID 118729008) has the molecular formula C44H32N4 and a molecular weight of 616.77 g/mol. Its IUPAC name is (4Z,10Z,15Z,19Z)-5,10,15,20-tetraphenyl-1,9,21,24-tetrahydroporphyrin.
| Compound Name | (4Z,10Z,15Z,19Z)-5,10,15,20-tetraphenyl-1,9,21,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 118729008 |
| Molecular Formula | C44H32N4 |
| Molecular Weight | 616.77 g/mol |
| Exact Mass | 616.26 |
| IUPAC Name | (4Z,10Z,15Z,19Z)-5,10,15,20-tetraphenyl-1,9,21,24-tetrahydroporphyrin |
| SMILES | C1=CC2N=C1/C(c1ccccc1)=C1/C=CC(N1)/C(c1ccccc1)=c1/cc/c([nH]1)=C(\c1ccccc1)C1=N/C(=C\2c2ccccc2)C=C1 |
| InChI | InChI=1S/C44H32N4/c1-5-13-29(14-6-1)41-33-21-23-35(45-33)42(30-15-7-2-8-16-30)37-25-27-39(47-37)44(32-19-11-4-12-20-32)40-28-26-38(48-40)43(31-17-9-3-10-18-31)36-24-22-34(41)46-36/h1-28,33,39,45-46H/b41-34-,42-35-,43-36-,44-40- |
| InChIKey | RMDCWYPQDLLEDR-HCVUDOQSSA-N |
| XLogP | 7.17 |
| TPSA | 52.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.77 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |