C16H22N2S4 — CID 118729228
6,13-diethyl-5,7,12,14-tetramethyl-2,3,9,10-tetrathia-6,13-diazatricyclo[9.3.0.04,8]tetradeca-1(14),4,7,11-tetraene (PubChem CID 118729228) has the molecular formula C16H22N2S4 and a molecular weight of 370.63 g/mol. Its IUPAC name is 6,13-diethyl-5,7,12,14-tetramethyl-2,3,9,10-tetrathia-6,13-diazatricyclo[9.3.0.04,8]tetradeca-1(14),4,7,11-tetraene.
| Compound Name | 6,13-diethyl-5,7,12,14-tetramethyl-2,3,9,10-tetrathia-6,13-diazatricyclo[9.3.0.04,8]tetradeca-1(14),4,7,11-tetraene |
|---|---|
| PubChem CID | 118729228 |
| Molecular Formula | C16H22N2S4 |
| Molecular Weight | 370.63 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | 6,13-diethyl-5,7,12,14-tetramethyl-2,3,9,10-tetrathia-6,13-diazatricyclo[9.3.0.04,8]tetradeca-1(14),4,7,11-tetraene |
| SMILES | CCn1c(C)c2c(c1C)SSc1c(c(C)n(CC)c1C)SS2 |
| InChI | InChI=1S/C16H22N2S4/c1-7-17-9(3)13-14(10(17)4)20-22-16-12(6)18(8-2)11(5)15(16)21-19-13/h7-8H2,1-6H3 |
| InChIKey | WXSUJQYOPXICGH-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.63 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|