C20H32O3 — CID 118729321
[(1R,4aR,5S,8aR)-5-[(2S)-2-hydroperoxy-3-methylidenepent-4-enyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methanol (PubChem CID 118729321) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is [(1R,4aR,5S,8aR)-5-[(2S)-2-hydroperoxy-3-methylidenepent-4-enyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methanol.
| Compound Name | [(1R,4aR,5S,8aR)-5-[(2S)-2-hydroperoxy-3-methylidenepent-4-enyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methanol |
|---|---|
| PubChem CID | 118729321 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | [(1R,4aR,5S,8aR)-5-[(2S)-2-hydroperoxy-3-methylidenepent-4-enyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-1-yl]methanol |
| SMILES | C=CC(=C)[C@H](C[C@H]1C(=C)CC[C@H]2[C@](C)(CO)CCC[C@]12C)OO |
| InChI | InChI=1S/C20H32O3/c1-6-14(2)17(23-22)12-16-15(3)8-9-18-19(4,13-21)10-7-11-20(16,18)5/h6,16-18,21-22H,1-3,7-13H2,4-5H3/t16-,17-,18-,19-,20+/m0/s1 |
| InChIKey | XZRSBBFTAAKSPT-VYJAJWGXSA-N |
| XLogP | 4.75 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|