C20H21NO8 — CID 118729344
[(2R,3S,4S,5R,6S)-6-(4-acetylphenoxy)-3,4,5-trihydroxyoxan-2-yl]methyl pyridine-3-carboxylate (PubChem CID 118729344) has the molecular formula C20H21NO8 and a molecular weight of 403.39 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-6-(4-acetylphenoxy)-3,4,5-trihydroxyoxan-2-yl]methyl pyridine-3-carboxylate.
| Compound Name | [(2R,3S,4S,5R,6S)-6-(4-acetylphenoxy)-3,4,5-trihydroxyoxan-2-yl]methyl pyridine-3-carboxylate |
|---|---|
| PubChem CID | 118729344 |
| Molecular Formula | C20H21NO8 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-6-(4-acetylphenoxy)-3,4,5-trihydroxyoxan-2-yl]methyl pyridine-3-carboxylate |
| SMILES | CC(=O)c1ccc(O[C@@H]2O[C@H](COC(=O)c3cccnc3)[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C20H21NO8/c1-11(22)12-4-6-14(7-5-12)28-20-18(25)17(24)16(23)15(29-20)10-27-19(26)13-3-2-8-21-9-13/h2-9,15-18,20,23-25H,10H2,1H3/t15-,16-,17+,18-,20-/m1/s1 |
| InChIKey | HXAMLEGFEXHYSU-BFMVXSJESA-N |
| XLogP | 0.33 |
| TPSA | 135.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |