About 6-[3-(trifluoromethyl)phenyl]-1,2λ6-benzoxathiine 2,2-dioxide
6-[3-(trifluoromethyl)phenyl]-1,2λ6-benzoxathiine 2,2-dioxide (PubChem CID 118729384) has the molecular formula C15H9F3O3S
and a molecular weight of 326.30 g/mol. Its IUPAC name is 6-[3-(trifluoromethyl)phenyl]-1,2λ6-benzoxathiine 2,2-dioxide.
Molecular Properties
| Compound Name | 6-[3-(trifluoromethyl)phenyl]-1,2λ6-benzoxathiine 2,2-dioxide |
| PubChem CID | 118729384 |
| Molecular Formula | C15H9F3O3S |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 6-[3-(trifluoromethyl)phenyl]-1,2λ6-benzoxathiine 2,2-dioxide |
| SMILES | O=S1(=O)C=Cc2cc(-c3cccc(C(F)(F)F)c3)ccc2O1 |
| InChI | InChI=1S/C15H9F3O3S/c16-15(17,18)13-3-1-2-10(9-13)11-4-5-14-12(8-11)6-7-22(19,20)21-14/h1-9H |
| InChIKey | FQHGEPUFTBCJNW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 6-[3-(trifluoromethyl)phenyl]-1,2λ6-benzoxathiine 2,2-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3-(trifluoromethyl)phenyl]-1,2λ6-benzoxathiine 2,2-dioxide?
The IUPAC name of 6-[3-(trifluoromethyl)phenyl]-1,2λ6-benzoxathiine 2,2-dioxide (CID 118729384) is 6-[3-(trifluoromethyl)phenyl]-1,2λ6-benzoxathiine 2,2-dioxide.
What is the SMILES notation for 6-[3-(trifluoromethyl)phenyl]-1,2λ6-benzoxathiine 2,2-dioxide?
The canonical SMILES for 6-[3-(trifluoromethyl)phenyl]-1,2λ6-benzoxathiine 2,2-dioxide is O=S1(=O)C=Cc2cc(-c3cccc(C(F)(F)F)c3)ccc2O1.
What is the InChIKey of 6-[3-(trifluoromethyl)phenyl]-1,2λ6-benzoxathiine 2,2-dioxide?
The InChIKey is FQHGEPUFTBCJNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9F3O3S/c16-15(17,18)13-3-1-2-10(9-13)11-4-5-14-12(8-11)6-7-22(19,20)21-14/h1-9H.
What are the key properties of 6-[3-(trifluoromethyl)phenyl]-1,2λ6-benzoxathiine 2,2-dioxide?
6-[3-(trifluoromethyl)phenyl]-1,2λ6-benzoxathiine 2,2-dioxide has a molecular weight of 326.30 g/mol, XLogP of 4.07, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3-(trifluoromethyl)phenyl]-1,2λ6-benzoxathiine 2,2-dioxide is sourced from PubChem (CID 118729384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).