About methyl 3-(2,2-dioxo-1,2λ6-benzoxathiin-6-yl)benzoate
methyl 3-(2,2-dioxo-1,2λ6-benzoxathiin-6-yl)benzoate (PubChem CID 118729385) has the molecular formula C16H12O5S
and a molecular weight of 316.33 g/mol. Its IUPAC name is methyl 3-(2,2-dioxo-1,2λ6-benzoxathiin-6-yl)benzoate.
Molecular Properties
| Compound Name | methyl 3-(2,2-dioxo-1,2λ6-benzoxathiin-6-yl)benzoate |
| PubChem CID | 118729385 |
| Molecular Formula | C16H12O5S |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | methyl 3-(2,2-dioxo-1,2λ6-benzoxathiin-6-yl)benzoate |
| SMILES | COC(=O)c1cccc(-c2ccc3c(c2)C=CS(=O)(=O)O3)c1 |
| InChI | InChI=1S/C16H12O5S/c1-20-16(17)14-4-2-3-11(10-14)12-5-6-15-13(9-12)7-8-22(18,19)21-15/h2-10H,1H3 |
| InChIKey | ZJZJXWQUQRLVDE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-(2,2-dioxo-1,2λ6-benzoxathiin-6-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(2,2-dioxo-1,2λ6-benzoxathiin-6-yl)benzoate?
The IUPAC name of methyl 3-(2,2-dioxo-1,2λ6-benzoxathiin-6-yl)benzoate (CID 118729385) is methyl 3-(2,2-dioxo-1,2λ6-benzoxathiin-6-yl)benzoate.
What is the SMILES notation for methyl 3-(2,2-dioxo-1,2λ6-benzoxathiin-6-yl)benzoate?
The canonical SMILES for methyl 3-(2,2-dioxo-1,2λ6-benzoxathiin-6-yl)benzoate is COC(=O)c1cccc(-c2ccc3c(c2)C=CS(=O)(=O)O3)c1.
What is the InChIKey of methyl 3-(2,2-dioxo-1,2λ6-benzoxathiin-6-yl)benzoate?
The InChIKey is ZJZJXWQUQRLVDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12O5S/c1-20-16(17)14-4-2-3-11(10-14)12-5-6-15-13(9-12)7-8-22(18,19)21-15/h2-10H,1H3.
What are the key properties of methyl 3-(2,2-dioxo-1,2λ6-benzoxathiin-6-yl)benzoate?
methyl 3-(2,2-dioxo-1,2λ6-benzoxathiin-6-yl)benzoate has a molecular weight of 316.33 g/mol, XLogP of 2.83, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(2,2-dioxo-1,2λ6-benzoxathiin-6-yl)benzoate is sourced from PubChem (CID 118729385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).