About 3-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2-oxazole
3-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2-oxazole (PubChem CID 118729456) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol. Its IUPAC name is 3-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2-oxazole.
Molecular Properties
| Compound Name | 3-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2-oxazole |
| PubChem CID | 118729456 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 3-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2-oxazole |
| SMILES | CN1CCC=C(c2ccon2)C1 |
| InChI | InChI=1S/C9H12N2O/c1-11-5-2-3-8(7-11)9-4-6-12-10-9/h3-4,6H,2,5,7H2,1H3 |
| InChIKey | URBUMUJCBDKJGD-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2-oxazole?
The IUPAC name of 3-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2-oxazole (CID 118729456) is 3-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2-oxazole.
What is the SMILES notation for 3-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2-oxazole?
The canonical SMILES for 3-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2-oxazole is CN1CCC=C(c2ccon2)C1.
What is the InChIKey of 3-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2-oxazole?
The InChIKey is URBUMUJCBDKJGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O/c1-11-5-2-3-8(7-11)9-4-6-12-10-9/h3-4,6H,2,5,7H2,1H3.
What are the key properties of 3-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2-oxazole?
3-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2-oxazole has a molecular weight of 164.21 g/mol, XLogP of 1.39, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2-oxazole is sourced from PubChem (CID 118729456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).