C28H35NO2 — CID 118729887
cis-ethyl (1R,2S)-2-[methyl-[3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propyl]amino]cyclohexane-1-carboxylate (PubChem CID 118729887) has the molecular formula C28H35NO2 and a molecular weight of 417.59 g/mol. Its IUPAC name is cis-ethyl (1R,2S)-2-[methyl-[3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propyl]amino]cyclohexane-1-carboxylate.
| Compound Name | cis-ethyl (1R,2S)-2-[methyl-[3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propyl]amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 118729887 |
| Molecular Formula | C28H35NO2 |
| Molecular Weight | 417.59 g/mol |
| Exact Mass | 417.27 |
| IUPAC Name | cis-ethyl (1R,2S)-2-[methyl-[3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propyl]amino]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCC[C@@H]1N(C)CCC=C1c2ccccc2CCc2ccccc21 |
| InChI | InChI=1S/C28H35NO2/c1-3-31-28(30)26-15-8-9-17-27(26)29(2)20-10-16-25-23-13-6-4-11-21(23)18-19-22-12-5-7-14-24(22)25/h4-7,11-14,16,26-27H,3,8-10,15,17-20H2,1-2H3/t26-,27+/m1/s1 |
| InChIKey | FUPLLNVZIPQQNU-SXOMAYOGSA-N |
| XLogP | 5.66 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.59 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'} |
|---|