C19H15Cl2FN6OS — CID 118730091
2-(2,4-dichlorophenyl)-1-[[5-(4-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-(1,2,4-triazol-1-yl)propan-2-ol (PubChem CID 118730091) has the molecular formula C19H15Cl2FN6OS and a molecular weight of 465.34 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-1-[[5-(4-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-(1,2,4-triazol-1-yl)propan-2-ol.
| Compound Name | 2-(2,4-dichlorophenyl)-1-[[5-(4-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-(1,2,4-triazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 118730091 |
| Molecular Formula | C19H15Cl2FN6OS |
| Molecular Weight | 465.34 g/mol |
| Exact Mass | 464.04 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-1-[[5-(4-fluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-(1,2,4-triazol-1-yl)propan-2-ol |
| SMILES | OC(CSc1n[nH]c(-c2ccc(F)cc2)n1)(Cn1cncn1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H15Cl2FN6OS/c20-13-3-6-15(16(21)7-13)19(29,8-28-11-23-10-24-28)9-30-18-25-17(26-27-18)12-1-4-14(22)5-2-12/h1-7,10-11,29H,8-9H2,(H,25,26,27) |
| InChIKey | RMUMDZNABSVWER-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.34 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |