C19H15Cl3N6OS — CID 118730092
1-[[5-(4-chlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-2-(2,4-dichlorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-ol (PubChem CID 118730092) has the molecular formula C19H15Cl3N6OS and a molecular weight of 481.80 g/mol. Its IUPAC name is 1-[[5-(4-chlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-2-(2,4-dichlorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-ol.
| Compound Name | 1-[[5-(4-chlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-2-(2,4-dichlorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 118730092 |
| Molecular Formula | C19H15Cl3N6OS |
| Molecular Weight | 481.80 g/mol |
| Exact Mass | 480.01 |
| IUPAC Name | 1-[[5-(4-chlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-2-(2,4-dichlorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-ol |
| SMILES | OC(CSc1n[nH]c(-c2ccc(Cl)cc2)n1)(Cn1cncn1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H15Cl3N6OS/c20-13-3-1-12(2-4-13)17-25-18(27-26-17)30-9-19(29,8-28-11-23-10-24-28)15-6-5-14(21)7-16(15)22/h1-7,10-11,29H,8-9H2,(H,25,26,27) |
| InChIKey | ZDPOVXODWZAIAM-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.80 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |