C19H14Cl4N6OS — CID 118730094
2-(2,4-dichlorophenyl)-1-[[5-(2,4-dichlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-(1,2,4-triazol-1-yl)propan-2-ol (PubChem CID 118730094) has the molecular formula C19H14Cl4N6OS and a molecular weight of 516.24 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-1-[[5-(2,4-dichlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-(1,2,4-triazol-1-yl)propan-2-ol.
| Compound Name | 2-(2,4-dichlorophenyl)-1-[[5-(2,4-dichlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-(1,2,4-triazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 118730094 |
| Molecular Formula | C19H14Cl4N6OS |
| Molecular Weight | 516.24 g/mol |
| Exact Mass | 513.97 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-1-[[5-(2,4-dichlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-(1,2,4-triazol-1-yl)propan-2-ol |
| SMILES | OC(CSc1n[nH]c(-c2ccc(Cl)cc2Cl)n1)(Cn1cncn1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H14Cl4N6OS/c20-11-1-3-13(15(22)5-11)17-26-18(28-27-17)31-8-19(30,7-29-10-24-9-25-29)14-4-2-12(21)6-16(14)23/h1-6,9-10,30H,7-8H2,(H,26,27,28) |
| InChIKey | AWQPDKWLTIHYCH-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.24 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |