C19H15Cl4N7OS — CID 118730097
1-[[4-amino-5-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-2-(2,4-dichlorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-ol (PubChem CID 118730097) has the molecular formula C19H15Cl4N7OS and a molecular weight of 531.26 g/mol. Its IUPAC name is 1-[[4-amino-5-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-2-(2,4-dichlorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-ol.
| Compound Name | 1-[[4-amino-5-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-2-(2,4-dichlorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 118730097 |
| Molecular Formula | C19H15Cl4N7OS |
| Molecular Weight | 531.26 g/mol |
| Exact Mass | 528.98 |
| IUPAC Name | 1-[[4-amino-5-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-2-(2,4-dichlorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-ol |
| SMILES | Nn1c(SCC(O)(Cn2cncn2)c2ccc(Cl)cc2Cl)nnc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H15Cl4N7OS/c20-11-1-3-13(15(22)5-11)17-27-28-18(30(17)24)32-8-19(31,7-29-10-25-9-26-29)14-4-2-12(21)6-16(14)23/h1-6,9-10,31H,7-8,24H2 |
| InChIKey | IQFVZJLUXGAWDG-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 107.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.26 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |