C11H12N2OS — CID 118730100
8-methoxy-3,4-dihydro-2H-pyrimido[1,2-b][1,2]benzothiazole (PubChem CID 118730100) has the molecular formula C11H12N2OS and a molecular weight of 220.30 g/mol. Its IUPAC name is 8-methoxy-3,4-dihydro-2H-pyrimido[1,2-b][1,2]benzothiazole.
| Compound Name | 8-methoxy-3,4-dihydro-2H-pyrimido[1,2-b][1,2]benzothiazole |
|---|---|
| PubChem CID | 118730100 |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 8-methoxy-3,4-dihydro-2H-pyrimido[1,2-b][1,2]benzothiazole |
| SMILES | COc1ccc2c(c1)SN1CCCN=C21 |
| InChI | InChI=1S/C11H12N2OS/c1-14-8-3-4-9-10(7-8)15-13-6-2-5-12-11(9)13/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | SAYINCGNTQEOFZ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|