C11H12N2S — CID 118730107
9-methyl-3,4-dihydro-2H-pyrimido[1,2-b][1,2]benzothiazole (PubChem CID 118730107) has the molecular formula C11H12N2S and a molecular weight of 204.30 g/mol. Its IUPAC name is 9-methyl-3,4-dihydro-2H-pyrimido[1,2-b][1,2]benzothiazole.
| Compound Name | 9-methyl-3,4-dihydro-2H-pyrimido[1,2-b][1,2]benzothiazole |
|---|---|
| PubChem CID | 118730107 |
| Molecular Formula | C11H12N2S |
| Molecular Weight | 204.30 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 9-methyl-3,4-dihydro-2H-pyrimido[1,2-b][1,2]benzothiazole |
| SMILES | Cc1ccc2c(c1)C1=NCCCN1S2 |
| InChI | InChI=1S/C11H12N2S/c1-8-3-4-10-9(7-8)11-12-5-2-6-13(11)14-10/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | LYNRUKUVURBZRN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.30 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|