C15H13N3S — CID 118730125
8-pyridin-4-yl-3,4-dihydro-2H-pyrimido[1,2-b][1,2]benzothiazole (PubChem CID 118730125) has the molecular formula C15H13N3S and a molecular weight of 267.36 g/mol. Its IUPAC name is 8-pyridin-4-yl-3,4-dihydro-2H-pyrimido[1,2-b][1,2]benzothiazole.
| Compound Name | 8-pyridin-4-yl-3,4-dihydro-2H-pyrimido[1,2-b][1,2]benzothiazole |
|---|---|
| PubChem CID | 118730125 |
| Molecular Formula | C15H13N3S |
| Molecular Weight | 267.36 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 8-pyridin-4-yl-3,4-dihydro-2H-pyrimido[1,2-b][1,2]benzothiazole |
| SMILES | c1cc(-c2ccc3c(c2)SN2CCCN=C32)ccn1 |
| InChI | InChI=1S/C15H13N3S/c1-6-17-15-13-3-2-12(11-4-7-16-8-5-11)10-14(13)19-18(15)9-1/h2-5,7-8,10H,1,6,9H2 |
| InChIKey | YNRYVRDAWHPHSD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|