C33H40N4O2 — CID 118730198
N-[[5-[3-[1-[(8-methoxyquinolin-5-yl)methyl]piperidin-4-yl]propoxy]-1-methylindol-2-yl]methyl]-N-methylprop-2-yn-1-amine (PubChem CID 118730198) has the molecular formula C33H40N4O2 and a molecular weight of 524.71 g/mol. Its IUPAC name is N-[[5-[3-[1-[(8-methoxyquinolin-5-yl)methyl]piperidin-4-yl]propoxy]-1-methylindol-2-yl]methyl]-N-methylprop-2-yn-1-amine.
| Compound Name | N-[[5-[3-[1-[(8-methoxyquinolin-5-yl)methyl]piperidin-4-yl]propoxy]-1-methylindol-2-yl]methyl]-N-methylprop-2-yn-1-amine |
|---|---|
| PubChem CID | 118730198 |
| Molecular Formula | C33H40N4O2 |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.32 |
| IUPAC Name | N-[[5-[3-[1-[(8-methoxyquinolin-5-yl)methyl]piperidin-4-yl]propoxy]-1-methylindol-2-yl]methyl]-N-methylprop-2-yn-1-amine |
| SMILES | C#CCN(C)Cc1cc2cc(OCCCC3CCN(Cc4ccc(OC)c5ncccc45)CC3)ccc2n1C |
| InChI | InChI=1S/C33H40N4O2/c1-5-17-35(2)24-28-21-27-22-29(11-12-31(27)36(28)3)39-20-7-8-25-14-18-37(19-15-25)23-26-10-13-32(38-4)33-30(26)9-6-16-34-33/h1,6,9-13,16,21-22,25H,7-8,14-15,17-20,23-24H2,2-4H3 |
| InChIKey | KAMCYDVYIMMVEU-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 42.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|