About cis-(1R,2R)-1-benzyl-2-(4-chlorophenyl)cyclopropan-1-amine;hydrochloride
cis-(1R,2R)-1-benzyl-2-(4-chlorophenyl)cyclopropan-1-amine;hydrochloride (PubChem CID 118730242) has the molecular formula C16H17Cl2N
and a molecular weight of 294.23 g/mol. Its IUPAC name is cis-(1R,2R)-1-benzyl-2-(4-chlorophenyl)cyclopropan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | cis-(1R,2R)-1-benzyl-2-(4-chlorophenyl)cyclopropan-1-amine;hydrochloride |
| PubChem CID | 118730242 |
| Molecular Formula | C16H17Cl2N |
| Molecular Weight | 294.23 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | cis-(1R,2R)-1-benzyl-2-(4-chlorophenyl)cyclopropan-1-amine;hydrochloride |
| SMILES | Cl.N[C@@]1(Cc2ccccc2)C[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H16ClN.ClH/c17-14-8-6-13(7-9-14)15-11-16(15,18)10-12-4-2-1-3-5-12;/h1-9,15H,10-11,18H2;1H/t15-,16+;/m1./s1 |
| InChIKey | QJFSESZPFZLTCH-RCPFAERMSA-N |
| XLogP | 4.19 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.23 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cis-(1R,2R)-1-benzyl-2-(4-chlorophenyl)cyclopropan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1R,2R)-1-benzyl-2-(4-chlorophenyl)cyclopropan-1-amine;hydrochloride?
The IUPAC name of cis-(1R,2R)-1-benzyl-2-(4-chlorophenyl)cyclopropan-1-amine;hydrochloride (CID 118730242) is cis-(1R,2R)-1-benzyl-2-(4-chlorophenyl)cyclopropan-1-amine;hydrochloride.
What is the SMILES notation for cis-(1R,2R)-1-benzyl-2-(4-chlorophenyl)cyclopropan-1-amine;hydrochloride?
The canonical SMILES for cis-(1R,2R)-1-benzyl-2-(4-chlorophenyl)cyclopropan-1-amine;hydrochloride is Cl.N[C@@]1(Cc2ccccc2)C[C@@H]1c1ccc(Cl)cc1.
What is the InChIKey of cis-(1R,2R)-1-benzyl-2-(4-chlorophenyl)cyclopropan-1-amine;hydrochloride?
The InChIKey is QJFSESZPFZLTCH-RCPFAERMSA-N. The full InChI is InChI=1S/C16H16ClN.ClH/c17-14-8-6-13(7-9-14)15-11-16(15,18)10-12-4-2-1-3-5-12;/h1-9,15H,10-11,18H2;1H/t15-,16+;/m1./s1.
What are the key properties of cis-(1R,2R)-1-benzyl-2-(4-chlorophenyl)cyclopropan-1-amine;hydrochloride?
cis-(1R,2R)-1-benzyl-2-(4-chlorophenyl)cyclopropan-1-amine;hydrochloride has a molecular weight of 294.23 g/mol, XLogP of 4.19, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,2R)-1-benzyl-2-(4-chlorophenyl)cyclopropan-1-amine;hydrochloride is sourced from PubChem (CID 118730242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).